Cobalt(II) chlorate: Difference between revisions
Appearance
Content deleted Content added
Updating {{chembox}} (no changed fields - updated 'UNII_Ref', 'ChEMBL_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBot |
rm suspicious image |
||
(38 intermediate revisions by 19 users not shown) | |||
Line 1: | Line 1: | ||
{{Chembox |
{{Chembox |
||
| Watchedfields = changed |
|||
| verifiedrevid = |
| verifiedrevid = 414081638 |
||
| ImageFile = cobalt (II) chlorate.svg |
|||
| |
| ImageFile = |
||
| |
| ImageSize = |
||
| |
| IUPACName = |
||
| |
| SystematicName = |
||
| OtherNames = cobaltous chlorate |
|||
| |
|Section1={{Chembox Identifiers |
||
| Abbreviations = |
| Abbreviations = |
||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 14688171 |
| ChemSpiderID = 14688171 |
||
Line 17: | Line 18: | ||
| StdInChIKey = IQYVXTLKMOTJKI-UHFFFAOYSA-L |
| StdInChIKey = IQYVXTLKMOTJKI-UHFFFAOYSA-L |
||
| InChIKey1 = IQYVXTLKMOTJKI-UHFFFAOYSA-L |
| InChIKey1 = IQYVXTLKMOTJKI-UHFFFAOYSA-L |
||
| CASNo = |
| CASNo = |
||
| EINECS = |
| EINECS = |
||
| |
| PubChem = 20034997 |
||
| PubChem = |
|||
| SMILES = [Co+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O |
| SMILES = [Co+2].[O-]Cl(=O)=O.[O-]Cl(=O)=O |
||
| |
| RTECS = |
||
| RTECS = |
|||
| MeSHName = |
| MeSHName = |
||
| ChEBI = |
| ChEBI = |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = |
| KEGG = |
||
}} |
|||
| ATCCode_prefix = |
|||
⚫ | |||
| ATCCode_suffix = |
|||
| ATC_Supplemental =}} |
|||
⚫ | |||
| Formula = Co(ClO<sub>3</sub>)<sub>2</sub> |
| Formula = Co(ClO<sub>3</sub>)<sub>2</sub> |
||
| MolarMass = 225.9 g/mol |
| MolarMass = 225.9 g/mol |
||
| Appearance = |
| Appearance = pink crystals |
||
| Density = |
| Density = |
||
| MeltingPt = |
| MeltingPt = |
||
| MeltingPt_notes = |
|||
| Melting_notes = |
|||
| BoilingPt = |
| BoilingPt = |
||
| BoilingPt_notes = |
|||
| Boiling_notes = |
|||
| Solubility = |
| Solubility = soluble in water |
||
| SolubleOther = |
| SolubleOther = |
||
| Solvent = |
| Solvent = |
||
| LogP = |
| LogP = |
||
| VaporPressure = |
| VaporPressure = |
||
| HenryConstant = |
| HenryConstant = |
||
| AtmosphericOHRateConstant = |
| AtmosphericOHRateConstant = |
||
| pKa = |
| pKa = |
||
| pKb = }} |
| pKb = }} |
||
| |
|Section3={{Chembox Structure |
||
| CrystalStruct = |
| CrystalStruct = |
||
| Coordination = |
| Coordination = |
||
| MolShape = }} |
| MolShape = }} |
||
| |
|Section4={{Chembox Thermochemistry |
||
| DeltaHf = |
| DeltaHf = |
||
| DeltaHc = |
| DeltaHc = |
||
| Entropy = |
| Entropy = |
||
| HeatCapacity = }} |
| HeatCapacity = }} |
||
| |
|Section5={{Chembox Pharmacology |
||
| AdminRoutes = |
| AdminRoutes = |
||
| Bioavail = |
| Bioavail = |
||
| Metabolism = |
| Metabolism = |
||
| HalfLife = |
| HalfLife = |
||
| ProteinBound = |
| ProteinBound = |
||
| Excretion = |
| Excretion = |
||
| Legal_status = |
| Legal_status = |
||
| Legal_US = |
| Legal_US = |
||
| Legal_UK = |
| Legal_UK = |
||
| Legal_AU = |
| Legal_AU = |
||
| Legal_CA = |
| Legal_CA = |
||
| Pregnancy_category = |
|||
| PregCat = |
|||
| |
| Pregnancy_AU = |
||
| |
| Pregnancy_US = }} |
||
| |
|Section6={{Chembox Explosive |
||
| ShockSens = |
| ShockSens = |
||
| FrictionSens = |
| FrictionSens = |
||
| |
| DetonationV = |
||
| REFactor = }} |
| REFactor = }} |
||
| |
|Section7={{Chembox Hazards |
||
| |
| MainHazards = |
||
| |
| NFPA-H = |
||
| |
| NFPA-F = |
||
| NFPA- |
| NFPA-R = |
||
| NFPA- |
| NFPA-S = |
||
| |
| FlashPt = |
||
| |
| AutoignitionPt = |
||
| |
| ExploLimits = |
||
| SPhrases = |
|||
| RSPhrases = |
|||
| FlashPt = |
|||
| Autoignition = |
|||
| ExploLimits = |
|||
| PEL = }} |
| PEL = }} |
||
| |
|Section8={{Chembox Related |
||
| OtherAnions = |
| OtherAnions = |
||
| OtherCations = |
| OtherCations = [[nickel chlorate]] |
||
[[iron chlorate]] |
|||
| OtherFunctn = |
|||
| |
| OtherFunction = |
||
| OtherFunction_label = |
|||
| OtherCpds = }} |
|||
| OtherCompounds = |
|||
}} |
|||
}} |
}} |
||
'''Cobalt(II) chlorate''' is a [[chemical compound]] with the formula Co(ClO<sub>3</sub>)<sub>2</sub>. |
'''Cobalt(II) chlorate''' is a [[chemical compound]] with the formula Co(ClO<sub>3</sub>)<sub>2</sub>. It is an [[oxidant]], as are all chlorates. |
||
== Preparation == |
|||
Cobalt(II) chlorate is formed by a double displacement reaction between [[cobalt(II) sulfate]] and [[barium chlorate]], [[barium sulfate]] precipitates and cobalt chlorate can be crystallized out of the filtrate:<ref>《无机化学丛书》.第九卷 锰分族 铁系 铂系. P<sub>303</sub>. 卤酸钴和高卤酸钴</ref> |
|||
: CoSO<sub>4</sub> + Ba(ClO<sub>3</sub>)<sub>2</sub> → BaSO<sub>4</sub> + Co(ClO<sub>3</sub>)<sub>2</sub> |
: CoSO<sub>4</sub> + Ba(ClO<sub>3</sub>)<sub>2</sub> → BaSO<sub>4</sub> + Co(ClO<sub>3</sub>)<sub>2</sub> |
||
It is also possible to make it by the reaction of any chlorate with a cobalt(II) salt, however the pure product is harder to separate. |
|||
It is an oxidant, as are all chlorates. |
|||
==References== |
==References== |
||
<references/> |
<references /> |
||
{{Cobalt compounds}} |
{{Cobalt compounds}} |
||
{{Chlorates}} |
|||
[[Category:Cobalt compounds]] |
[[Category:Cobalt(II) compounds]] |
||
[[Category:Chlorates]] |
[[Category:Chlorates]] |
||
[[Category:Oxidizing agents]] |
[[Category:Oxidizing agents]] |